3'-Fluoro-4'-(trifluoromethyl)acetophenone structure
|
Common Name | 3'-Fluoro-4'-(trifluoromethyl)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 237761-81-8 | Molecular Weight | 206.137 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 225.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H6F4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 85.1±21.5 °C | |
| Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 225.6±40.0 °C at 760 mmHg |
| Molecular Formula | C9H6F4O |
| Molecular Weight | 206.137 |
| Flash Point | 85.1±21.5 °C |
| Exact Mass | 206.035477 |
| PSA | 17.07000 |
| LogP | 2.76 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.433 |
| InChIKey | NXQBONPKAOTSNA-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(C(F)(F)F)c(F)c1 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(3-Fluoro-4-(trifluoromethyl)phenyl)ethanone |
| 1-[3-Fluoro-4-(trifluoromethyl)phenyl]ethanone |
| Ethanone, 1-[3-fluoro-4-(trifluoromethyl)phenyl]- |
| MFCD00236273 |
| 3'-Fluoro-4'-(trifluoromethyl)acetophenone |
| FXFFR BF DV1 |