Perfluoro-tert-butanol structure
|
Common Name | Perfluoro-tert-butanol | ||
|---|---|---|---|---|
| CAS Number | 2378-02-1 | Molecular Weight | 236.03600 | |
| Density | 1.693 g/mL at 25 °C(lit.) | Boiling Point | 45 °C(lit.) | |
| Molecular Formula | C4HF9O | Melting Point | -17°C | |
| MSDS | Chinese USA | Flash Point | 44-45°C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.693 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 45 °C(lit.) |
| Melting Point | -17°C |
| Molecular Formula | C4HF9O |
| Molecular Weight | 236.03600 |
| Flash Point | 44-45°C |
| Exact Mass | 235.98800 |
| PSA | 20.23000 |
| LogP | 2.40440 |
| Vapour Pressure | 45.7mmHg at 25°C |
| Index of Refraction | n20/D 1.3(lit.) |
| InChIKey | XZNOAVNRSFURIR-UHFFFAOYSA-N |
| SMILES | OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| Storage condition | Keep Cold |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H332-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xn,Xi,T |
| Risk Phrases | R20 |
| Safety Phrases | S26-S45-S36/37 |
| RIDADR | UN 2810 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | UB6452700 |
| HS Code | 2905590090 |
| Precursor 8 | |
|---|---|
| DownStream 3 | |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Greener fluorous chemistry: Convenient preparation of new types of 'CF< sub> 3</sub>-rich'secondary alkyl mesylates and their use for the synthesis of azides, amines, imidazoles and imidazolium salts Nemes A, et al.
J. Fluor. Chem. 131(12) , 1368-76, (2010)
|
|
|
Cyclization and rearrangement products from coupling reactions between terminal< i> o</i>-alkynylphenols or< i> o</i>-ethynyl (hydroxymethyl) benzene and 6-halopurines. Berg TC, et al.
Tetrahedron 62(25) , 6121-31, (2006)
|
| 2,2,2-trifluoro-1,1-bis(trifluoromethyl)ethanol |
| Nonafluor-terc.butanol [Czech] |
| 1,1,1,3,3,3-Hexafluoro-2-trifluoromethyl-2-propanol |
| Perfluoro-tert-butyl alcohol |
| 1,1,1,3,3,3-Hexafluoro-2-(trifluoromethyl)-2-propanol |
| Nonafluoro-tert-butanol |
| EINECS 219-157-3 |
| nonafluoro-tert-butyl alcohol |
| MFCD00042092 |
| tris(trifluoromethyl)-tert-butanol |
| Perfluoro-tert-butanol |