3-(4-chlorophenyl)-N,N-dimethylprop-2-enamide structure
|
Common Name | 3-(4-chlorophenyl)-N,N-dimethylprop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 23784-70-5 | Molecular Weight | 209.67200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-chlorophenyl)-N,N-dimethylprop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12ClNO |
|---|---|
| Molecular Weight | 209.67200 |
| Exact Mass | 209.06100 |
| PSA | 20.31000 |
| LogP | 2.44140 |
| InChIKey | CVKVSIGUIAIDTR-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C=Cc1ccc(Cl)cc1 |
|
~0%
3-(4-chlorophen... CAS#:23784-70-5 |
| Literature: Fujihara, Tetsuaki; Katafuchi, Yuko; Iwai, Tomohiro; Terao, Jun; Tsuji, Yasushi Journal of the American Chemical Society, 2010 , vol. 132, # 6 p. 2094 - 2098 |
|
~%
3-(4-chlorophen... CAS#:23784-70-5 |
| Literature: Chiriac, Constantin I.; Tanasa, Fulga; Nechifor, Marioara Revue Roumaine de Chimie, 2007 , vol. 52, # 10 p. 949 - 952 |
| 2-Propenamide,3-(4-chlorophenyl)-N,N-dimethyl |
| cis-4-Chlor-N,N-dimethylzimtamid |
| 4-Chlor-zimtsaeure-N,N-dimethylamid |
| 1-(4-chloro-phenyl)-3-dimethylamino-propenone |
| 4-Chlor-zimtsaeure-dimethylamid |
| N,N-Dimethyl-p-chlor-zimtsaeureamid |