JNJ-67569762 structure
|
Common Name | JNJ-67569762 | ||
|---|---|---|---|---|
| CAS Number | 2380313-26-6 | Molecular Weight | 530.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22F4N4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of JNJ-67569762JNJ-67569762 is a selective BACE1 inhibitor targeting the S3 pocket (IC50 = 2.7 nM). |
| Name | JNJ-67569762 |
|---|
| Description | JNJ-67569762 is a selective BACE1 inhibitor targeting the S3 pocket (IC50 = 2.7 nM). |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H22F4N4O5S |
|---|---|
| Molecular Weight | 530.49 |
| InChIKey | NDIQAOIHFVWZJQ-NHCUHLMSSA-N |
| SMILES | CCS(=O)(=O)C1(C)CCC(CF)(c2cc(NC(=O)c3cc4c(cn3)OC(F)(F)O4)ccc2F)N=C1N |