Boc-C1-PEG3-C4-OBn structure
|
Common Name | Boc-C1-PEG3-C4-OBn | ||
|---|---|---|---|---|
| CAS Number | 2381196-81-0 | Molecular Weight | 410.54 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H38O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Boc-C1-PEG3-C4-OBnBoc-C1-PEG3-C4-OBn (PROTAC Linker 15) is a PROTAC linker, which refers to the PEG composition. Boc-C1-PEG3-C4-OBn can be used in the synthesis of a series of PROTACs, such as PROTAC SGK3 degrader-1 (HY-125878). PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| Name | Boc-C1-PEG3-C4-OBn |
|---|
| Description | Boc-C1-PEG3-C4-OBn (PROTAC Linker 15) is a PROTAC linker, which refers to the PEG composition. Boc-C1-PEG3-C4-OBn can be used in the synthesis of a series of PROTACs, such as PROTAC SGK3 degrader-1 (HY-125878). PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| References |
| Molecular Formula | C23H38O6 |
|---|---|
| Molecular Weight | 410.54 |
| InChIKey | RBTVTEMDPRBJLY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCCCCCOCc1ccccc1 |
| Storage condition | -20°C |