N-Boc-PEG3-bromide structure
|
Common Name | N-Boc-PEG3-bromide | ||
|---|---|---|---|---|
| CAS Number | 165963-71-3 | Molecular Weight | 312.201 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 382.8±27.0 °C at 760 mmHg | |
| Molecular Formula | C11H22BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.3±23.7 °C | |
Use of N-Boc-PEG3-bromideN-Boc-PEG3-bromide is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | 2-[2-(2-t-Boc-aminoethoxy]ethoxy]ethyl Bromide |
|---|---|
| Synonym | More Synonyms |
| Description | N-Boc-PEG3-bromide is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 382.8±27.0 °C at 760 mmHg |
| Molecular Formula | C11H22BrNO4 |
| Molecular Weight | 312.201 |
| Flash Point | 185.3±23.7 °C |
| Exact Mass | 311.073212 |
| PSA | 60.28000 |
| LogP | 1.75 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | WGWDCMKAMHBDPO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCBr |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|
| Carbamic acid, N-[2-[2-(2-bromoethoxy)ethoxy]ethyl]-, 1,1-dimethylethyl ester |
| tert-butyl N-[2-[2-(2-bromoethoxy)ethoxy]ethyl]carbamate |
| 2-Methyl-2-propanyl {2-[2-(2-bromoethoxy)ethoxy]ethyl}carbamate |