AC-TRP-OET structure
|
Common Name | AC-TRP-OET | ||
|---|---|---|---|---|
| CAS Number | 2382-80-1 | Molecular Weight | 274.315 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 517.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C15H18N2O3 | Melting Point | 112-114 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 266.8±27.3 °C | |
| Name | ethyl (2S)-2-acetamido-3-(1H-indol-3-yl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 517.6±40.0 °C at 760 mmHg |
| Melting Point | 112-114 °C(lit.) |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.315 |
| Flash Point | 266.8±27.3 °C |
| Exact Mass | 274.131744 |
| PSA | 71.19000 |
| LogP | 1.53 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | KQGQONPKSKUHHT-AWEZNQCLSA-N |
| SMILES | CCOC(=O)C(Cc1c[nH]c2ccccc12)NC(C)=O |
| Storage condition | -15°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| L-Tryptophan, N-acetyl-, ethyl ester |
| (S)-Ethyl 2-acetamido-3-(1H-indol-3-yl)propanoate |
| N-Ac-Trp-O-Et |
| Ethyl N-Acetyl-L-tryptophan |
| N-Acetyl-L-tryptophan ethyl estert |
| N-Acetyl-L-tryptophan Ethyl Ester |
| N-acetyl-L-tryptophane ethyl ester |
| N-Acetyltryptophan ethyl ester |
| EINECS 219-190-3 |
| Ethyl N-acetyl-L-tryptophanate |
| Ac-Trp-OEt |
| MFCD00005643 |