2-Acetoxy-5-(bromoacetyl)benzyl acetate structure
|
Common Name | 2-Acetoxy-5-(bromoacetyl)benzyl acetate | ||
|---|---|---|---|---|
| CAS Number | 24085-07-2 | Molecular Weight | 329.143 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 428.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H13BrO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.1±28.7 °C | |
| Name | [2-acetyloxy-5-(2-bromoacetyl)phenyl]methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 428.7±45.0 °C at 760 mmHg |
| Molecular Formula | C13H13BrO5 |
| Molecular Weight | 329.143 |
| Flash Point | 213.1±28.7 °C |
| Exact Mass | 327.994629 |
| PSA | 69.67000 |
| LogP | 1.53 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | QVJPOKCPMZBJOX-UHFFFAOYSA-N |
| SMILES | CC(=O)OCc1cc(C(=O)CBr)ccc1OC(C)=O |
| Storage condition | -20°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2915390090 |
|
~%
2-Acetoxy-5-(br... CAS#:24085-07-2 |
| Literature: Organic Letters, , vol. 4, # 22 p. 3793 - 3796 |
|
~%
2-Acetoxy-5-(br... CAS#:24085-07-2 |
| Literature: Organic Letters, , vol. 4, # 22 p. 3793 - 3796 |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 4-Hydroxy-3-hydroxymethylbromoacetophenone diacetate |
| 2-Acetoxymethyl-4-bromoacetylphenyl acetate |
| Ethanone, 1-[4-(acetyloxy)-3-[(acetyloxy)methyl]phenyl]-2-bromo- |
| 2-Acetoxy-5-(bromoacetyl)benzyl acetate |
| 2-Acetoxymethyl-4-bromophenyl Acetate |
| 4-Acetoxy-3-acetoxymethyl-a-bromoacetophenone |
| 4-Acetoxy-3-acetoxyMethyl-α-bromoacetophenone |
| 1-[4-(Acetyloxy)-3-[(acetyloxy)methyl]phenyl]-2-bromoethanone |