1H-Isoindole-1,3(2H)-dione,4,5,6,7-tetrabromo- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,4,5,6,7-tetrabromo- | ||
|---|---|---|---|---|
| CAS Number | 24407-32-7 | Molecular Weight | 462.71500 | |
| Density | 2.685g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8HBr4NO2 | Melting Point | >300ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,5,6,7-tetrabromoisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 2.685g/cm3 |
|---|---|
| Melting Point | >300ºC |
| Molecular Formula | C8HBr4NO2 |
| Molecular Weight | 462.71500 |
| Exact Mass | 458.67400 |
| PSA | 46.17000 |
| LogP | 3.94900 |
| Index of Refraction | 1.721 |
| InChIKey | QRFTXHFUNIFHST-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)c2c(Br)c(Br)c(Br)c(Br)c21 |
|
~86%
1H-Isoindole-1,... CAS#:24407-32-7 |
| Literature: Nikpour, Farzad; Kazemi, Samira; Sheikh, Davood Heterocycles, 2006 , vol. 68, # 8 p. 1559 - 1564 |
|
~%
1H-Isoindole-1,... CAS#:24407-32-7 |
| Literature: Pratt; Young Journal of the American Chemical Society, 1918 , vol. 40, p. 1416 |
|
~%
1H-Isoindole-1,... CAS#:24407-32-7 |
| Literature: Pratt; Young Journal of the American Chemical Society, 1918 , vol. 40, p. 1416 |
|
~%
1H-Isoindole-1,... CAS#:24407-32-7 |
| Literature: Velsicol Chemical Corporation Patent: US3950307 A1, 1976 ; |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4,5,6,7-Tetrabrom-isoindolin-1,3-dion |
| 3,4,5,6-tetrabromophthalimide |
| 4,5,6,7-tetrabromophthalimide |
| 1H-Isoindole-1,3(2H)-dione,4,5,6,7-tetrabromo |
| 4,5,6,7-tetrabromo-2H-benzo[c]azoline-1,3-dione |
| bis-tetrabromophthalimide |
| 4,5,6,7-Tetrabromo-1H-isoindole-1,3(2H)-dione |
| 4,5,6,7-tetrabromo-isoindoline-1,3-dione |
| Tetrabromophthalimide |