trimethyl 1,2,4-benzenetricarboxylate structure
|
Common Name | trimethyl 1,2,4-benzenetricarboxylate | ||
|---|---|---|---|---|
| CAS Number | 2459-10-1 | Molecular Weight | 252.22000 | |
| Density | 1.261 g/mL at 25 °C(lit.) | Boiling Point | 194 °C12 mm Hg(lit.) | |
| Molecular Formula | C12H12O6 | Melting Point | 38-40 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Name | trimethyl benzene-1,2,4-tricarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 194 °C12 mm Hg(lit.) |
| Melting Point | 38-40 °C(lit.) |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22000 |
| Flash Point | >230 °F |
| Exact Mass | 252.06300 |
| PSA | 78.90000 |
| LogP | 1.04640 |
| Vapour Pressure | 9.81E-05mmHg at 25°C |
| Index of Refraction | n20/D 1.523(lit.) |
| InChIKey | MJHNUUNSCNRGJE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(C(=O)OC)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2917399090 |
| Precursor 7 | |
|---|---|
| DownStream 7 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Standard enthalpies of formation of some methyl esters of benzene carboxylic acids. Maksimuk YV, et al.
J. Chem. Eng. Data 43(3) , 293-98, (1998)
|
|
|
Construction of polymer skeletons with radiation-scissile groups at predetermined sites. Shimizu T, et al.
J. Polym. Sci. A Polym. Chem. 46(6) , 1945-53, (2008)
|
| 1,2,4-trimethylbenzenetricarboxylate |
| Trimellitic Acid Trimethyl Ester |
| EINECS 219-547-3 |
| MFCD00043629 |
| Trimethyl 1,2,4-Benzenetricarboxylate |
| Methyl trimellitate |
| Trimethyl trimellitate |
| 1,2,4-benzenetricarboxylic acid trimethyl ester |
| benzene-1,2,4-tricarboxylic acid trimethyl ester |