tetranor-PGEM (tetranor-Prostaglandin E Metabolite) structure
|
Common Name | tetranor-PGEM (tetranor-Prostaglandin E Metabolite) | ||
|---|---|---|---|---|
| CAS Number | 24769-56-0 | Molecular Weight | 328.358 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 622.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C16H24O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 344.2±28.0 °C | |
Use of tetranor-PGEM (tetranor-Prostaglandin E Metabolite)PGE-M is a metabolite of prostaglandin E2 (PEG2) as a biomarker of inflammation and cancer including advanced colorectal neoplasia, ovarian cancer, prostate cancer and so on. Urinary PGE-M is positively associated with obesity, smoking and lung metastases with breast cancer[1][2][3]. |
| Name | 9,15-dioxo-11alpha-hydroxy-2,3,4,5-tetranor-prostan-1,20-dioic acid |
|---|---|
| Synonym | More Synonyms |
| Description | PGE-M is a metabolite of prostaglandin E2 (PEG2) as a biomarker of inflammation and cancer including advanced colorectal neoplasia, ovarian cancer, prostate cancer and so on. Urinary PGE-M is positively associated with obesity, smoking and lung metastases with breast cancer[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 622.4±55.0 °C at 760 mmHg |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.358 |
| Flash Point | 344.2±28.0 °C |
| Exact Mass | 328.152191 |
| PSA | 128.97000 |
| LogP | -0.90 |
| Vapour Pressure | 0.0±4.1 mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | ZJAZCYLYLVCSNH-JHJVBQTASA-N |
| SMILES | O=C(O)CCCCC(=O)CCC1C(O)CC(=O)C1CCC(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 8-[(1R,2R,5R)-2-(2-Carboxyethyl)-5-hydroxy-3-oxocyclopentyl]-6-oxooctanoic acid |
| Cyclopentaneoctanoic acid, 2-(2-carboxyethyl)-5-hydroxy-η,3-dioxo-, (1R,2R,5R)- |
| 11alpha-hydroxy-9,15-dioxo-2,3,4,5,20-pentanor-19-carboxyprostanoicacid |
| 8-[(1R,2R,5R)-2-(2-Carboxyethyl)-5-hydroxy-3-oxocyclopentyl]-8-oxooctanoic acid |
| TETRANOR-PGEM |
| tetranor-prostaglandin E metabolite |
| Cyclopentaneoctanoic acid, 2-(2-carboxyethyl)-5-hydroxy-ε,3-dioxo-, (1R,2R,5R)- |
| tetranor-PGEM Lipid Maps MS Standard |