(E)-4-(4-hydroxyphenyl)-4-oxo-but-2-enoic acid structure
|
Common Name | (E)-4-(4-hydroxyphenyl)-4-oxo-but-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 86690-79-1 | Molecular Weight | 192.16800 | |
| Density | 1.366g/cm3 | Boiling Point | 426.6ºC at 760mmHg | |
| Molecular Formula | C10H8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226ºC | |
| Name | (E)-4-(4-hydroxyphenyl)-4-oxobut-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.366g/cm3 |
|---|---|
| Boiling Point | 426.6ºC at 760mmHg |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.16800 |
| Flash Point | 226ºC |
| Exact Mass | 192.04200 |
| PSA | 74.60000 |
| LogP | 1.21570 |
| InChIKey | LQCBGQDCRBYBMK-AATRIKPKSA-N |
| SMILES | O=C(O)C=CC(=O)c1ccc(O)cc1 |
|
~%
(E)-4-(4-hydrox... CAS#:86690-79-1 |
| Literature: Papa et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 3356,3357 |
|
~35%
(E)-4-(4-hydrox... CAS#:86690-79-1 |
| Literature: Bianchi, Mario; Butti, Alina; Christidis, Yani; Perronnet, Jacques; Barzaghi, Fernando; et al. European Journal of Medicinal Chemistry, 1988 , vol. 23, p. 45 - 52 |
| HMS2760A09 |
| 4-Oxo-4-(4-hydroxy-phenyl)-trans-crotonsaeure |
| 3-(4-hydroxybenzoyl)acrylic acid |
| (2E)-4-(4-hydroxyphenyl)-4-oxobut-2-enoic acid |
| 4-oxo-4-(4-hydroxy-phenyl)-trans-crotonic acid |