2-Chloro-3,5-dinitrobenzoic acid structure
|
Common Name | 2-Chloro-3,5-dinitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2497-91-8 | Molecular Weight | 246.56200 | |
| Density | 1.791 g/cm3 | Boiling Point | 240-241°C | |
| Molecular Formula | C7H3ClN2O6 | Melting Point | 196-199°C | |
| MSDS | N/A | Flash Point | 200.8ºC | |
| Name | 2-Chloro-3,5-dinitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.791 g/cm3 |
|---|---|
| Boiling Point | 240-241°C |
| Melting Point | 196-199°C |
| Molecular Formula | C7H3ClN2O6 |
| Molecular Weight | 246.56200 |
| Flash Point | 200.8ºC |
| Exact Mass | 245.96800 |
| PSA | 128.94000 |
| LogP | 2.90100 |
| Vapour Pressure | 2.12E-07mmHg at 25°C |
| InChIKey | ADTKEYLCJYYHHH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1Cl |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RTECS | DG4996500 |
| HS Code | 2916399090 |
|
~%
2-Chloro-3,5-di... CAS#:2497-91-8 |
| Literature: Monatshefte fuer Chemie, , vol. 22, p. 386 DE106510 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 5, p. 147 |
|
~90%
2-Chloro-3,5-di... CAS#:2497-91-8 |
| Literature: Akhtar, Nahid; Munawar, M. A.; Siddiq, M. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1986 , vol. 25, p. 328 |
|
~%
2-Chloro-3,5-di... CAS#:2497-91-8 |
| Literature: DE106510 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 5, p. 147 |
|
~%
2-Chloro-3,5-di... CAS#:2497-91-8 |
| Literature: Recueil des Travaux Chimiques des Pays-Bas, , vol. 20, p. 235 |
|
~%
2-Chloro-3,5-di... CAS#:2497-91-8 |
| Literature: Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), , # 5 p. 645 - 650 |
|
~%
2-Chloro-3,5-di... CAS#:2497-91-8 |
| Literature: Gazzetta Chimica Italiana, , vol. 32 I, p. 531 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3,5-dinitro-2-chlorobenzoic acid |
| 2-Carboxy-4,6-dinitrochlorobenzene |
| 3,5-dinitro-1-carboxy-2-chlorobenzene |
| 2-chloro-3,5-dinitro-benzoic acid |
| EINECS 219-684-9 |
| 5-dinitrobenzoic acid |
| 2-Chloro-3,5-Dinitrobenzoic Acid |
| 2-Chlor-3,5-dinitro-benzoesaeure |
| BENZOIC ACID,2-CHLORO-3,5-DINITRO |
| 2-chloro-3,5-dinitrobenzenecarboxylic acid |
| MFCD00007070 |