Methyl 3,5-di-tert-butyl-4-hydroxybenzoate structure
|
Common Name | Methyl 3,5-di-tert-butyl-4-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 2511-22-0 | Molecular Weight | 264.36000 | |
| Density | 1.02g/cm3 | Boiling Point | 334.8ºC at 760mmHg | |
| Molecular Formula | C16H24O3 | Melting Point | 164-166°C | |
| MSDS | N/A | Flash Point | 126.4ºC | |
| Name | methyl 3,5-ditert-butyl-4-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 334.8ºC at 760mmHg |
| Melting Point | 164-166°C |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36000 |
| Flash Point | 126.4ºC |
| Exact Mass | 264.17300 |
| PSA | 46.53000 |
| LogP | 3.77380 |
| Vapour Pressure | 6.41E-05mmHg at 25°C |
| Index of Refraction | 1.503 |
| InChIKey | UPVYFJALDJUSOV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 3,5-bis(1,1-dimethylethyl)-4-hydroxy-benzoic acid,methyl ester |
| EINECS 219-729-2 |
| 4-carbomethoxy-2,6-di-tert-butylphenol |
| MFCD00017253 |
| methyl 3,5-di-t-butyl-4-hydroxybenzoate |
| 4-(methoxycarbonyl)-2,6-di-tert-butylphenol |
| methyl 3,5-di-tert-butyl-4-hydroxybenzoate |
| Benzoic acid,3,5-bis(1,1-dimethylethyl)-4-hydroxy-,methyl ester |