Phenol,2,6-bis(1,1-dimethylethyl)-4-(methoxymethyl) structure
|
Common Name | Phenol,2,6-bis(1,1-dimethylethyl)-4-(methoxymethyl) | ||
|---|---|---|---|---|
| CAS Number | 87-97-8 | Molecular Weight | 250.37600 | |
| Density | 0.961g/cm3 | Boiling Point | 286.3ºC at 760 mmHg | |
| Molecular Formula | C16H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 90.9ºC | |
| Name | 2,6-ditert-butyl-4-(methoxymethyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.961g/cm3 |
|---|---|
| Boiling Point | 286.3ºC at 760 mmHg |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.37600 |
| Flash Point | 90.9ºC |
| Exact Mass | 250.19300 |
| PSA | 29.46000 |
| LogP | 4.13360 |
| Index of Refraction | 1.496 |
| InChIKey | SCXYLTWTWUGEAA-UHFFFAOYSA-N |
| SMILES | COCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2909500000 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Name: Activity against caspase-mediated apoptosis in mouse L1210 cells
Source: ChEMBL
Target: L1210
External Id: CHEMBL914538
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| Agidol 42 |
| 2,6-di-tert-butyl-4-methoxymethylene-phenol |
| Ethyl Antioxidant 762 |
| EINECS 201-787-5 |
| Methyl ether of 3,5-di-tert-butyl-4-hydroxybenzene |
| 2,6-Di-tert-butyl-4-methoxymethylphenol |
| Ionol 4 |