2,6-Dichloro-4-nitropyridine structure
|
Common Name | 2,6-Dichloro-4-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 25194-01-8 | Molecular Weight | 192.988 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 282.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C5H2Cl2N2O2 | Melting Point | 94-98ºC | |
| MSDS | Chinese USA | Flash Point | 124.9±25.9 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2,6-dichloro-4-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 282.9±35.0 °C at 760 mmHg |
| Melting Point | 94-98ºC |
| Molecular Formula | C5H2Cl2N2O2 |
| Molecular Weight | 192.988 |
| Flash Point | 124.9±25.9 °C |
| Exact Mass | 191.949326 |
| PSA | 58.71000 |
| LogP | 1.87 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | BZYQSSVTQJTUDD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)nc(Cl)c1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H317-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R37/38;R41;R43 |
| Safety Phrases | S26-S39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
|
~68%
2,6-Dichloro-4-... CAS#:25194-01-8 |
| Literature: Xuanzhu Pharmaco., Ltd. Patent: EP2524917 A1, 2012 ; Location in patent: Page/Page column 58-59 ; |
|
~%
2,6-Dichloro-4-... CAS#:25194-01-8 |
| Literature: US4453972 A1, ; |
|
~69%
2,6-Dichloro-4-... CAS#:25194-01-8 |
| Literature: Palmer, Andreas Marc; Muench, Gabriela; Brehm, Christof; Zimmermann, Peter Jan; Buhr, Wilm; Feth, Martin Philipp; Simon, Wolfgang Alexander Bioorganic and Medicinal Chemistry, 2008 , vol. 16, # 3 p. 1511 - 1530 |
|
~%
2,6-Dichloro-4-... CAS#:25194-01-8 |
| Literature: Nucleosides, Nucleotides and Nucleic Acids, , vol. 22, # 12 p. 2133 - 2144 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| T6NJ BG DNW FG |
| 2,5-DIBROMO-4-METHYL-3-NITRO-PYRIDINE |
| 4-nitro-2,6-dichloro-pyridine |
| MFCD05670545 |
| Pyridine,2,6-dichloro-4-nitro |
| Pyridine, 2,6-dichloro-4-nitro- |
| 2,6-Dichloro-4-nitropyridine |
| 2,6-dichloro-4-nitro-pyridine |