(3α)-3-Hydroxyolean-12-en-28-oic acid structure
|
Common Name | (3α)-3-Hydroxyolean-12-en-28-oic acid | ||
|---|---|---|---|---|
| CAS Number | 25499-90-5 | Molecular Weight | 456.700 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 553.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O3 | Melting Point | 297-299 °C | |
| MSDS | N/A | Flash Point | 302.6±26.6 °C | |
Use of (3α)-3-Hydroxyolean-12-en-28-oic acid3-Epioleanolic acid is an active component of Verbena officinalis Linn, with anti-inflammatory activity[1]. |
| Name | 3-Epioleanolic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 3-Epioleanolic acid is an active component of Verbena officinalis Linn, with anti-inflammatory activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 553.5±50.0 °C at 760 mmHg |
| Melting Point | 297-299 °C |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.700 |
| Flash Point | 302.6±26.6 °C |
| Exact Mass | 456.360352 |
| PSA | 57.53000 |
| LogP | 9.06 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | MIJYXULNPSFWEK-KDQGZELNSA-N |
| SMILES | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 |
| Storage condition | 2-8°C |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| Olean-12-en-28-oic acid, 3-hydroxy-, (3α)- |
| 3'-methylcedrusin |
| Betulininsaeure |
| Astrantiagenin C |
| Betulinsaeure |
| oleanolic acid |
| (3α)-3-Hydroxyolean-12-en-28-oic acid |
| Oleanolinsaeure |
| 3,5'-dimethoxy-4',7-epoxy-8,3'-neolignane-4,9,9'-triol |
| 8R)-dihydrodehydrodiconiferyl alcohol |
| betulic acid |
| Oleanolsaeure |