Dexchlorpheniramine structure
|
Common Name | Dexchlorpheniramine | ||
|---|---|---|---|---|
| CAS Number | 25523-97-1 | Molecular Weight | 274.78800 | |
| Density | 1.107g/cm3 | Boiling Point | 379ºC at 760mmHg | |
| Molecular Formula | C16H19ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183ºC | |
Use of DexchlorpheniramineDexchlorpheniramine is an potent and blood-brain barrier (BBB) penetrant histamine 1 (H1) receptor antagonist with anticholinergic properties. Dexchlorpheniramine can be used for researching allergies[1]. |
| Name | dexchlorpheniramine |
|---|---|
| Synonym | More Synonyms |
| Description | Dexchlorpheniramine is an potent and blood-brain barrier (BBB) penetrant histamine 1 (H1) receptor antagonist with anticholinergic properties. Dexchlorpheniramine can be used for researching allergies[1]. |
|---|---|
| Related Catalog | |
| In Vivo | Dexchlorpheniramine (2-10 mg/kg; IP, single dosage) and Ranitidine (10-50 mg/kg) co-administration can Simultaneous blockade of H1 and H2 receptors, and protects both the cortical plate and the white matter against the excitotoxic challenge in Swiss pups pretreated with IL-9[1]. |
| References |
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 379ºC at 760mmHg |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.78800 |
| Flash Point | 183ºC |
| Exact Mass | 274.12400 |
| PSA | 16.13000 |
| LogP | 3.81860 |
| Index of Refraction | 1.565 |
| InChIKey | SOYKEARSMXGVTM-HNNXBMFYSA-N |
| SMILES | CN(C)CCC(c1ccc(Cl)cc1)c1ccccn1 |
|
~%
Dexchlorpheniramine CAS#:25523-97-1 |
| Literature: Chirality, , vol. 22, # 1 p. 69 - 76 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Phendextro |
| (3S)-3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine |
| D-Chlorpheniramine |
| dexchlorphenamine |
| Isomerine |
| Dexclorfeniramina |
| Fortamine |
| Trenelone |
| Polaramin |
| DEXCHLORPHENIRAMINE |
| Destral |