Methyl 3-(trifluoromethyl)benzoate structure
|
Common Name | Methyl 3-(trifluoromethyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 2557-13-3 | Molecular Weight | 204.146 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 208.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H7F3O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 70.0±19.6 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Warning | |
| Name | Methyl 3-(trifluoromethyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 208.6±40.0 °C at 760 mmHg |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.146 |
| Flash Point | 70.0±19.6 °C |
| Exact Mass | 204.039810 |
| PSA | 26.30000 |
| LogP | 3.25 |
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
| Index of Refraction | 1.447 |
| InChIKey | QQHNNQCWKYFNAC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(C(F)(F)F)c1 |
| Storage condition | Flammables area |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R10;R36/37/38 |
| Safety Phrases | S26-S36/37/39-S37/39-S16 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 3.2 |
| HS Code | 2916399090 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-(Trifluoromethyl)benzoic acid methyl ester |
| MFCD00043543 |
| Methyl 3-trifluoromethylbenzoate |
| Methyl-3-(trifluormethyl)benzolcarboxylat |
| Benzoic acid, 3-(trifluoromethyl)-, methyl ester |
| Methyl α,α,α-Trifluoro-m-toluate |
| 3-(Trifluoromethyl) benzoic acid methyl ester |
| Methyl 3-(trifluoromethyl)benzoate |
| 3-Carbomethoxybenzotrifluoride |
| methyl m-trifluoromethylbenzoate |