Methyl 3-(trifluoromethyl)benzoylacetate structure
|
Common Name | Methyl 3-(trifluoromethyl)benzoylacetate | ||
|---|---|---|---|---|
| CAS Number | 93618-66-7 | Molecular Weight | 246.183 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 248.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H9F3O3 | Melting Point | 94-96°C | |
| MSDS | N/A | Flash Point | 101.2±20.8 °C | |
| Name | Methyl 3-trifluoromethylbenzoylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 248.7±35.0 °C at 760 mmHg |
| Melting Point | 94-96°C |
| Molecular Formula | C11H9F3O3 |
| Molecular Weight | 246.183 |
| Flash Point | 101.2±20.8 °C |
| Exact Mass | 246.050385 |
| PSA | 43.37000 |
| LogP | 2.39 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.460 |
| InChIKey | RPRMYRPHNDGZOY-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)c1cccc(C(F)(F)F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25-S25-S24 |
| HS Code | 2918300090 |
|
~%
Methyl 3-(trifl... CAS#:93618-66-7 |
| Literature: US2011/118510 A1, ; Page/Page column 4 ; |
|
~%
Methyl 3-(trifl... CAS#:93618-66-7 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 11, # 13 p. 2991 - 3013 |
|
~%
Methyl 3-(trifl... CAS#:93618-66-7 |
| Literature: US2012/65063 A1, ; Page/Page column 22 ; |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Methyl 3-oxo-3-[3-(trifluoromethyl)phenyl]propanoate |
| MFCD00216522 |
| Benzenepropanoic acid, β-oxo-3-(trifluoromethyl)-, methyl ester |