3-(Trifluoromethyl)benzoyl chloride structure
|
Common Name | 3-(Trifluoromethyl)benzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 2251-65-2 | Molecular Weight | 208.565 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 185.5±0.0 °C at 760 mmHg | |
| Molecular Formula | C8H4ClF3O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 75.5±27.3 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 3-(Trifluoromethyl)benzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 185.5±0.0 °C at 760 mmHg |
| Molecular Formula | C8H4ClF3O |
| Molecular Weight | 208.565 |
| Flash Point | 75.5±27.3 °C |
| Exact Mass | 207.990280 |
| PSA | 17.07000 |
| LogP | 3.27 |
| Vapour Pressure | 0.7±0.3 mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | RUJYJCANMOTJMO-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1cccc(C(F)(F)F)c1 |
| Water Solubility | decomposes |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R29;R34 |
| Safety Phrases | S26-S36/37/39-S45-S8 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2916399090 |
|
~%
3-(Trifluoromet... CAS#:2251-65-2 |
| Literature: Journal of the American Chemical Society, , vol. 70, p. 2837,2842 |
|
~%
3-(Trifluoromet... CAS#:2251-65-2 |
| Literature: Journal of the American Chemical Society, , vol. 70, p. 2837,2842 |
|
~%
3-(Trifluoromet... CAS#:2251-65-2 |
| Literature: WO2012/27965 A1, ; WO 2012/027965 A1 |
|
~%
3-(Trifluoromet... CAS#:2251-65-2 |
| Literature: Journal of the American Chemical Society, , vol. 136, # 9 p. 3354 - 3357 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Non-hinge-binding pyrazolo[1,5-a]pyrimidines as potent B-Raf kinase inhibitors
Bioorg. Med. Chem. Lett. 19(23) , 6519-23, (2009) Optimization of initial lead compound 1 provided a series of pyrazolo[1,5- a]pyrimidines 2 as potent B-Raf kinase inhibitors. |
| m-Toluoyl chloride, α,α,α-trifluoro- |
| m-Trifluiromethylbenzoyl chloride |
| α,α,α-Trifluoro-m-tolyl Chloride |
| 3-(Chlorocarbonyl)benzotrifluoride |
| Benzoyl chloride, 3-(trifluoromethyl)- |
| trifluoromethylbenzoyl chloride |
| GVR CXFFF |
| m-(Trifluoromethyl)benzoyl chloride |
| 3-(trifluoromethyl)-benzoyl chloride |
| 3-(trifluoromethyl)-benzoylchlorid |
| metha-trifluoromethylbenzoyl chloride |
| 3-CF3PhCOCl |
| MTF-BOC |
| 3-trifluoromethylbenzoic acid chloride |
| EINECS 218-844-5 |
| α,α,α-Trifluoro-m-toluoyl chloride |
| MFCD00000680 |
| 3-(Trifluoromethyl)benzoyl chloride |
| m-trifluoromethyl-benzoyl chloride |