ML-339 structure
|
Common Name | ML-339 | ||
|---|---|---|---|---|
| CAS Number | 2579689-83-9 | Molecular Weight | N/A | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | N/A | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ML-339ML 339 is a potent and selective hCXCR6 antagonist (IC50 = 140 nM); 100-fold less active at the murine CXCR6 receptor (IC50 = 18 μM). Exhibits selectivity over CXCR5, CXCR4, CCR6 and APJ receptors (IC50 >79 μM). |
| Name | ML-339 |
|---|
| Description | ML 339 is a potent and selective hCXCR6 antagonist (IC50 = 140 nM); 100-fold less active at the murine CXCR6 receptor (IC50 = 18 μM). Exhibits selectivity over CXCR5, CXCR4, CCR6 and APJ receptors (IC50 >79 μM). |
|---|
| InChIKey | SSPYAPRDKNCABY-YQQQUEKLSA-N |
|---|---|
| SMILES | COc1cc(C(=O)NC2CC3CCCC(C2)N3CC(=O)Nc2ccccc2Cl)cc(OC)c1OC |