Linderene acetate structure
|
Common Name | Linderene acetate | ||
|---|---|---|---|---|
| CAS Number | 26146-28-1 | Molecular Weight | 272.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Linderene acetateLinderene acetate, isolated from the root of Lindera strychnifolia, is a prolyl endopeptidase inhibitor[1]. |
| Name | Linderenyl-acetat |
|---|---|
| Synonym | More Synonyms |
| Description | Linderene acetate, isolated from the root of Lindera strychnifolia, is a prolyl endopeptidase inhibitor[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H20O3 |
|---|---|
| Molecular Weight | 272.33900 |
| Exact Mass | 272.14100 |
| PSA | 39.44000 |
| LogP | 3.57670 |
| InChIKey | ICLTVELXFUIGLS-FBHBFLDISA-N |
| SMILES | C=C1C2CC2C2(C)Cc3occ(C)c3C(OC(C)=O)C12 |
| Hazard Codes | Xi |
|---|
| Linderen-acetat |
| Acetic acid (1bS,6R,6aS)-1b,5-dimethyl-7-methylene-1,1a,1b,2,6,6a,7,7a-octahydro-3-oxa-cyclopropa[a]-s-indacen-6-yl ester |
| Linderenacetat |