N,N-dimethylglycylbenzocaine structure
|
Common Name | N,N-dimethylglycylbenzocaine | ||
|---|---|---|---|---|
| CAS Number | 78448-04-1 | Molecular Weight | 250.29400 | |
| Density | 1.152g/cm3 | Boiling Point | 414.4ºC at 760 mmHg | |
| Molecular Formula | C13H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.4ºC | |
| Name | ethyl 4-[[2-(dimethylamino)acetyl]amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.152g/cm3 |
|---|---|
| Boiling Point | 414.4ºC at 760 mmHg |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.29400 |
| Flash Point | 204.4ºC |
| Exact Mass | 250.13200 |
| PSA | 58.64000 |
| LogP | 1.43640 |
| Index of Refraction | 1.557 |
| InChIKey | DWKRVJWRHNPLHC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN(C)C)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
N,N-dimethylgly... CAS#:78448-04-1 |
| Literature: Sanna Annali di Chimica Applicata, 1935 , vol. 25, p. 638,641 |
|
~%
N,N-dimethylgly... CAS#:78448-04-1 |
| Literature: Einhorn Patent: DE106502 ; |
|
~%
N,N-dimethylgly... CAS#:78448-04-1 |
| Literature: Einhorn Patent: DE106502 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N-Dimethylglycylbenzocaine |
| JK-42 |