1h,1h,2h,2h-perfluorooctanethiol structure
|
Common Name | 1h,1h,2h,2h-perfluorooctanethiol | ||
|---|---|---|---|---|
| CAS Number | 34451-26-8 | Molecular Weight | 380.17000 | |
| Density | 1.62 | Boiling Point | 58ºC | |
| Molecular Formula | C8H5F13S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 56.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-thiol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62 |
|---|---|
| Boiling Point | 58ºC |
| Molecular Formula | C8H5F13S |
| Molecular Weight | 380.17000 |
| Flash Point | 56.8ºC |
| Exact Mass | 379.99000 |
| PSA | 38.80000 |
| LogP | 5.04510 |
| Index of Refraction | 1.321 |
| InChIKey | GTPHVVCYEWPQFE-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCS |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | 36-26 |
| RIDADR | UN 3334 |
| HS Code | 2930909090 |
|
~99%
1h,1h,2h,2h-per... CAS#:34451-26-8 |
| Literature: E. I. DU PONT DE NEMOURS AND COMPNAY Patent: US2009/143608 A1, 2009 ; Location in patent: Page/Page column 4 ; |
|
~%
1h,1h,2h,2h-per... CAS#:34451-26-8 |
| Literature: Rondestvedt,C.S.; Thayer,G.L. Journal of Organic Chemistry, 1977 , vol. 42, p. 2680 - 2683 |
|
~%
1h,1h,2h,2h-per... CAS#:34451-26-8 |
| Literature: Peroche, Sandrine; Parrot-Lopez, Helene Tetrahedron Letters, 2003 , vol. 44, # 2 p. 241 - 245 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1H,1H,2H,2H-Perfluorooctyl mercaptan |
| MFCD00792427 |
| 1H,1H,2H,2H-perfluorooctanethiol |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-octanethiol |
| 1,1,2,2-tetrahydroperfluorooctanethiol |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctanethiol |
| 1H,1H,2H,2H-Perfluoro-1-octanethiol |