1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-8-iodooctane structure
|
Common Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-8-iodooctane | ||
|---|---|---|---|---|
| CAS Number | 2043-57-4 | Molecular Weight | 474.00100 | |
| Density | 1.934 g/mL at 25 °C(lit.) | Boiling Point | 92 °C45 mm Hg(lit.) | |
| Molecular Formula | C8H4F13I | Melting Point | 21 °C | |
| MSDS | Chinese USA | Flash Point | 177 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-8-iodooctane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.934 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 92 °C45 mm Hg(lit.) |
| Melting Point | 21 °C |
| Molecular Formula | C8H4F13I |
| Molecular Weight | 474.00100 |
| Flash Point | 177 °F |
| Exact Mass | 473.91500 |
| LogP | 5.55030 |
| Vapour Pressure | 1.29mmHg at 25°C |
| Index of Refraction | n20/D 1.359(lit.) |
| InChIKey | NVVZEKTVIXIUKW-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCI |
| Water Solubility | insoluble |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2903799090 |
|
~89%
1,1,1,2,2,3,3,4... CAS#:2043-57-4 |
| Literature: Peroche, Sandrine; Parrot-Lopez, Helene Tetrahedron Letters, 2003 , vol. 44, # 2 p. 241 - 245 |
|
~95%
1,1,1,2,2,3,3,4... CAS#:2043-57-4 |
| Literature: Qing, Feng-Ling; Ji, Min; Lu, Ronghua; Yan, Kelu; Mao, Zhiping Journal of Fluorine Chemistry, 2002 , vol. 113, # 1 p. 139 - 141 |
|
~50%
1,1,1,2,2,3,3,4... CAS#:2043-57-4 |
| Literature: Journal of Fluorine Chemistry, , vol. 20, p. 255 - 266 |
|
~0%
1,1,1,2,2,3,3,4... CAS#:2043-57-4 |
| Literature: Werner, Konrad Von Journal of Fluorine Chemistry, 1985 , vol. 28, p. 229 - 234 |
|
~48%
Detail
|
| Literature: Journal of Fluorine Chemistry, , vol. 20, p. 255 - 266 |
|
Detail
|
| Literature: EP1757578 A1, ; Page/Page column 6-7 ; |
| Precursor 7 | |
|---|---|
| DownStream 9 | |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-perfluorohexyl-1-iodoethane |
| 1H,1H,2H,2H-Perfluoro-1-iodo-n-octane |
| 1H,1H,2H,2H-Perfluoro-n-octyl Iodide |
| 1-iodo-1H,1H,2H,2H-perfluorooctane |
| 1,1,1,2,2,3,3,4,4,5,5,6,6,-tridecafluoro-8-iodooctane |
| MFCD00039410 |
| 8-Iodo-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorooctane |
| 1H,1H,2H,2H-Perfluorooctyl iodide |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-iodooctane |
| 1H,1H,2H,2H-Tridecafluoro-1-iodo-n-octane |
| EINECS 218-056-1 |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl iodide |
| 1H,1H,2H,2H-Tridecafluoro-n-octyl Iodide |