2'-Azido-2'-deoxyuridine structure
|
Common Name | 2'-Azido-2'-deoxyuridine | ||
|---|---|---|---|---|
| CAS Number | 26929-65-7 | Molecular Weight | 269.214 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11N5O5 | Melting Point | 149-153ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2'-Azido-2'-deoxyuridine2'-Azido-2'-deoxyuridine (N3dUrd) is a ribonucleotide reductase inhibitor. 2'-Azido-2'-deoxyuridine has anti-cancer activity[1]. |
| Name | 2′-Azido-2′-deoxyuridine |
|---|---|
| Synonym | More Synonyms |
| Description | 2'-Azido-2'-deoxyuridine (N3dUrd) is a ribonucleotide reductase inhibitor. 2'-Azido-2'-deoxyuridine has anti-cancer activity[1]. |
|---|---|
| Related Catalog | |
| In Vitro | 2'-Azido-2'-deoxyuridine (N3dUrd) has IC50s of >350 μM for ribonucleotide reductase activity in chinese hamster ovary (CHO) and 3T6 cell[1]. |
| References |
| Melting Point | 149-153ºC |
|---|---|
| Molecular Formula | C9H11N5O5 |
| Molecular Weight | 269.214 |
| Exact Mass | 269.076019 |
| PSA | 154.30000 |
| LogP | -1.10 |
| InChIKey | MRUKYOQQKHNMFI-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NC1C(O)C(CO)OC1n1ccc(=O)[nH]c1=O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25 |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Uridine, 2'-azido-2'-deoxy- |
| 2'-Azido-2'-deoxyuridine |