4-Piperidinecarboxylicacid, 1-(2-phenylacetyl)- structure
|
Common Name | 4-Piperidinecarboxylicacid, 1-(2-phenylacetyl)- | ||
|---|---|---|---|---|
| CAS Number | 26965-32-2 | Molecular Weight | 247.29000 | |
| Density | 1.225g/cm3 | Boiling Point | 478.2ºC at 760 mmHg | |
| Molecular Formula | C14H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243ºC | |
| Name | 1-(2-phenylacetyl)piperidine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 478.2ºC at 760 mmHg |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29000 |
| Flash Point | 243ºC |
| Exact Mass | 247.12100 |
| PSA | 57.61000 |
| LogP | 1.49020 |
| Vapour Pressure | 5.94E-10mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | OTVPLNPLEZXHGE-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CCN(C(=O)Cc2ccccc2)CC1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Phenylacetylisonipecotic acid |
| 1-(phenylacetyl)piperidine-4-carboxylic acid |