Boc-(R)-3-amino-4-(4-cyanophenyl)-butyric acid structure
|
Common Name | Boc-(R)-3-amino-4-(4-cyanophenyl)-butyric acid | ||
|---|---|---|---|---|
| CAS Number | 269726-86-5 | Molecular Weight | 304.341 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 498.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H20N2O4 | Melting Point | 85 °C | |
| MSDS | Chinese USA | Flash Point | 255.4±28.7 °C | |
| Name | Boc-(R)-3-amino-4-(4-cyanophenyl)-butyric acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 498.6±45.0 °C at 760 mmHg |
| Melting Point | 85 °C |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.341 |
| Flash Point | 255.4±28.7 °C |
| Exact Mass | 304.142303 |
| PSA | 99.42000 |
| LogP | 2.48 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | UXSGGQWSQPYJTQ-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)Cc1ccc(C#N)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~%
Boc-(R)-3-amino... CAS#:269726-86-5 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 18 p. 4759 - 4762 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (3R)-3-Amino-4-(4-cyanophenyl)-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid |
| Benzenebutanoic acid, 4-cyano-β-[[(1,1-dimethylethoxy)carbonyl]amino]-, (βR)- |
| boc-(r)-3-amino-4-(4-cyano-phenyl)-butyric acid |
| Pentanedioic acid, 3-amino-2-(4-cyanophenyl)-, 1-(1,1-dimethylethyl) ester, (3R)- |
| (3R)-4-(4-Cyanophenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid |
| MFCD01860981 |