Boc-D-4-Cyanophenylalanine structure
|
Common Name | Boc-D-4-Cyanophenylalanine | ||
|---|---|---|---|---|
| CAS Number | 146727-62-0 | Molecular Weight | 290.314 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 494.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H18N2O4 | Melting Point | 152.6ºC | |
| MSDS | Chinese USA | Flash Point | 252.6±28.7 °C | |
| Name | Boc-D-4-Cyano-phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 494.0±45.0 °C at 760 mmHg |
| Melting Point | 152.6ºC |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.314 |
| Flash Point | 252.6±28.7 °C |
| Exact Mass | 290.126648 |
| PSA | 99.42000 |
| LogP | 2.40 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | RMBLTLXJGNILPG-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(C#N)cc1)C(=O)O |
| Storage condition | -15°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2926909090 |
|
~%
Boc-D-4-Cyanoph... CAS#:146727-62-0 |
| Literature: WO2012/4678 A2, ; Page/Page column 32 ; WO 2012/004678 A2 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-Tert-Butoxycarbonyl-4-Cyanophenyl-D-Alanine |
| MFCD00672527 |
| L-Phenylalanine, 4-cyano-N-[(1,1-dimethylethoxy)carbonyl]- |
| D-Phenylalanine, 4-cyano-N-[(1,1-dimethylethoxy)carbonyl]- |
| (R)-N-Boc-4-Cyanophenylalanine |
| Boc-D-Phe(4-CN)-OH |
| Boc-4-cyano-D-phenylalanine |
| 4-Cyano-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine |
| (2S)-3-(4-Cyanophenyl)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| 4-Cyano-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalanine |
| N-(tert-Butoxycarbonyl)-4-cyano-L-phenylalanine |
| N-(tert-Butoxycarbonyl)-4-cyano-D-phenylalanine |
| N-(tert-Butoxycarbonyl)-4-cyan-L-phenylalanin |
| Boc-D-4-Cyanophenylalanine |