4-Methoxymethyl-2,3,5,6-tetrafluorobenzyl alcohol structure
|
Common Name | 4-Methoxymethyl-2,3,5,6-tetrafluorobenzyl alcohol | ||
|---|---|---|---|---|
| CAS Number | 83282-91-1 | Molecular Weight | 224.152 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 214.2±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H8F4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.8±22.5 °C | |
| Name | 4-Methoxymethyl-2,3,5,6-tetrafluorobenzenemethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 214.2±35.0 °C at 760 mmHg |
| Molecular Formula | C9H8F4O2 |
| Molecular Weight | 224.152 |
| Flash Point | 106.8±22.5 °C |
| Exact Mass | 224.046036 |
| PSA | 29.46000 |
| LogP | 1.01 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.464 |
| InChIKey | YFHZSPDQKWFAPH-UHFFFAOYSA-N |
| SMILES | COCc1c(F)c(F)c(CO)c(F)c1F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2942000000 |
|
~86%
4-Methoxymethyl... CAS#:83282-91-1 |
| Literature: Sumitomo Chemical Company, Limited Patent: EP1975147 A1, 2008 ; Location in patent: Page/Page column 8 ; |
|
~%
4-Methoxymethyl... CAS#:83282-91-1 |
| Literature: US2001/3138 A1, ; |
|
~%
4-Methoxymethyl... CAS#:83282-91-1 |
| Literature: US2001/3138 A1, ; |
|
~%
4-Methoxymethyl... CAS#:83282-91-1 |
| Literature: Zhang, Deyan; Chen, Zizhan; Cai, Huihua; Zou, Xinzhuo Journal of Fluorine Chemistry, 2009 , vol. 130, # 10 p. 938 - 941 |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| [2,3,5,6-Tetrafluoro-4-(methoxymethyl)phenyl]methanol |
| 4-Methoxymethyl-2,3,5,6-tetrafluorobenzyl alcohol |
| Benzenemethanol, 2,3,5,6-tetrafluoro-4-(methoxymethyl)- |
| MFCD08741397 |