MLKL-IN-5 structure
|
Common Name | MLKL-IN-5 | ||
|---|---|---|---|---|
| CAS Number | 2755872-58-1 | Molecular Weight | 416.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20N6O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MLKL-IN-5MLKL-IN-5 is a potent MLKL inhibitor that mediates necroptosis[1]. |
| Name | MLKL-IN-5 |
|---|
| Description | MLKL-IN-5 is a potent MLKL inhibitor that mediates necroptosis[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Jean-Marc Daniel GARNIER, et al. Sulphonamide compounds.WO2021253095. |
| Molecular Formula | C18H20N6O4S |
|---|---|
| Molecular Weight | 416.45 |
| InChIKey | WDIDNHYFQQNOBU-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)Nc1ccc(-c2[nH]nc(Nc3cccc(OC)n3)c2C(N)=O)cc1 |