MLKL-IN-2 structure
|
Common Name | MLKL-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 899759-16-1 | Molecular Weight | 423.51 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H25N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MLKL-IN-2MLKL-IN-2 is a MLKL inhibitor extracted from patent WO2021224505A1, compound (i)[1]. |
| Name | MLKL-IN-2 |
|---|
| Description | MLKL-IN-2 is a MLKL inhibitor extracted from patent WO2021224505A1, compound (i)[1]. |
|---|---|
| Related Catalog | |
| Target |
MLKL[1] |
| References |
[1]. Sáez AJG, et, al. Modulation of mixed lineage kinase domain-like protein signaling. WO2021224505A1. |
| Molecular Formula | C26H25N5O |
|---|---|
| Molecular Weight | 423.51 |
| InChIKey | CVHOXUUPSXOTPM-UHFFFAOYSA-N |
| SMILES | CN1CCN(c2ccc(-c3cccc(NC(=O)c4ccc5ccccc5c4)c3)nn2)CC1 |