mecoprop-methyl structure
|
Common Name | mecoprop-methyl | ||
|---|---|---|---|---|
| CAS Number | 2786-19-8 | Molecular Weight | 228.67200 | |
| Density | 1.201g/cm3 | Boiling Point | 277.042ºC at 760 mmHg | |
| Molecular Formula | C11H13ClO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 111.068ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | mecoprop-methyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201g/cm3 |
|---|---|
| Boiling Point | 277.042ºC at 760 mmHg |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.67200 |
| Flash Point | 111.068ºC |
| Exact Mass | 228.05500 |
| PSA | 35.53000 |
| LogP | 2.58870 |
| Appearance of Characters | Solid |
| Vapour Pressure | 0.005mmHg at 25°C |
| Index of Refraction | 1.51 |
| InChIKey | YWGAULPFWIQKRB-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)Oc1ccc(Cl)cc1C |
| Storage condition | 0-6°C |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317-H400 |
| Precautionary Statements | P273-P280 |
| Hazard Codes | F;Xn;C |
| Risk Phrases | R11;R38;R62;R65;R67;R48/20;R51/53;R52/53 |
| Safety Phrases | S61;S62;S36/S37 |
| RIDADR | UN 3082 9/PG 3 |
| Methyl 2-(4-chloro-2-methylphenoxy)propioate |
| rac-methyl (2R)-2-(4-chloro-2-methylphenoxy)propanoate |
| Methyl 2-(4-chloro-2-methylphenoxy)propanoate |
| methyl 2-(4-chloro-2-methylphenoxy)propanoate |
| methyl (RS)-2-(4-chloro-o-tolyloxy)propionate |