Benzoic acid,4-[(3-methyl-2-buten-1-yl)oxy]- structure
|
Common Name | Benzoic acid,4-[(3-methyl-2-buten-1-yl)oxy]- | ||
|---|---|---|---|---|
| CAS Number | 28090-15-5 | Molecular Weight | 206.23800 | |
| Density | 1.112g/cm3 | Boiling Point | 344ºC at 760mmHg | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.8ºC | |
| Name | 4-(3-methylbut-2-enoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.112g/cm3 |
|---|---|
| Boiling Point | 344ºC at 760mmHg |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.23800 |
| Flash Point | 130.8ºC |
| Exact Mass | 206.09400 |
| PSA | 46.53000 |
| LogP | 2.72980 |
| Vapour Pressure | 2.58E-05mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | KLZJDQVTNOMAKU-UHFFFAOYSA-N |
| SMILES | CC(C)=CCOc1ccc(C(=O)O)cc1 |
|
~10%
Benzoic acid,4-... CAS#:28090-15-5 |
| Literature: Epifano, Francesco; Menghini, Luigi; Pagiotti, Rita; Angelini, Paola; Genovese, Salvatore; Curini, Massimo Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 21 p. 5523 - 5525 |
|
~%
Benzoic acid,4-... CAS#:28090-15-5 |
| Literature: Lauer; Moe Journal of the American Chemical Society, 1943 , vol. 65, p. 289,292 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Valencic acid |