N-(Bis(4-methoxyphenyl)methyl)-2-chloroacetamide structure
|
Common Name | N-(Bis(4-methoxyphenyl)methyl)-2-chloroacetamide | ||
|---|---|---|---|---|
| CAS Number | 28230-40-2 | Molecular Weight | 319.78300 | |
| Density | 1.193g/cm3 | Boiling Point | 533.9ºC at 760mmHg | |
| Molecular Formula | C17H18ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.7ºC | |
| Name | N-[Bis(4-methoxyphenyl)methyl]-2-chloroacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 533.9ºC at 760mmHg |
| Molecular Formula | C17H18ClNO3 |
| Molecular Weight | 319.78300 |
| Flash Point | 276.7ºC |
| Exact Mass | 319.09800 |
| PSA | 51.05000 |
| LogP | 3.98850 |
| Vapour Pressure | 1.78E-11mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | HZJCCFDHIZXGTH-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(NC(=O)CCl)c2ccc(OC)cc2)cc1 |
| Hazard Codes | C |
|---|---|
| HS Code | 2924299090 |
|
~85%
N-(Bis(4-methox... CAS#:28230-40-2 |
| Literature: Henneuse, Catherine; Boxus, Thierry; Tesolin, Lorenzo; Pantano, Guiseppe; Marchand-Brynaert, Jacqueline Synthesis, 1996 , # 4 p. 495 - 501 |
|
~%
N-(Bis(4-methox... CAS#:28230-40-2 |
| Literature: Koenig,W.; Geiger,R. Chemische Berichte, 1970 , vol. 103, p. 2041 - 2051 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Chloressigsaeure-(4,4'-dimethoxy-benzhydrylamid) |
| N-(4,4'-dimethoxybenzhydryl)chloroacetamide |