Bis(4-methoxyphenyl)methanol structure
|
Common Name | Bis(4-methoxyphenyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 728-87-0 | Molecular Weight | 244.286 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 406.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H16O3 | Melting Point | 67-70 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 199.6±28.7 °C | |
| Name | 4,4'-dimethoxybenzhydrol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 406.5±45.0 °C at 760 mmHg |
| Melting Point | 67-70 °C(lit.) |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.286 |
| Flash Point | 199.6±28.7 °C |
| Exact Mass | 244.109940 |
| PSA | 38.69000 |
| LogP | 2.57 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | ZODAOVNETBTTJX-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(O)c2ccc(OC)cc2)cc1 |
| Water Solubility | methanol: 0.1 g/mL, clear |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
|
One-Step Hydroxy Substitution of 4, 4'-Dimethoxybenzhydrol with Amides, Lactams, Carbamates, Ureas and Anilines. Henneuse C, et al.
Synthesis 1996(04) , 495-501, (1996)
|
|
|
Kinetics and mechanism of oxidation of some substituted benzhydrols by N-bromosuccinimide. Hiran BL, et al.
Kinet. Catal. 46(3) , 334-39, (2005)
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| Bis(p-methoxyphenyl)carbinol |
| Bis(4-methoxyphenyl)methanol |
| EINECS 211-975-9 |
| 4-Methoxy-4'-methoxybenzhydrol |
| MFCD00008410 |