4-Chloroisophthalic acid structure
|
Common Name | 4-Chloroisophthalic acid | ||
|---|---|---|---|---|
| CAS Number | 2845-85-4 | Molecular Weight | 200.57600 | |
| Density | 1.586g/cm3 | Boiling Point | 424.9ºC at 760mmHg | |
| Molecular Formula | C8H5ClO4 | Melting Point | >290℃ | |
| MSDS | N/A | Flash Point | 210.8ºC | |
| Name | 4-Chloroisophthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.586g/cm3 |
|---|---|
| Boiling Point | 424.9ºC at 760mmHg |
| Melting Point | >290℃ |
| Molecular Formula | C8H5ClO4 |
| Molecular Weight | 200.57600 |
| Flash Point | 210.8ºC |
| Exact Mass | 199.98800 |
| PSA | 74.60000 |
| LogP | 1.73640 |
| Vapour Pressure | 5.59E-08mmHg at 25°C |
| Index of Refraction | 1.63 |
| InChIKey | APLYBKHRTXFIBT-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Cl)c(C(=O)O)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2917399090 |
| Precursor 8 | |
|---|---|
| DownStream 5 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-chlorobenzene-1,3-dicarboxylic acid |