1,4-Dichloro-9,10-anthraquinone structure
|
Common Name | 1,4-Dichloro-9,10-anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 602-25-5 | Molecular Weight | 277.102 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 455.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H6Cl2O2 | Melting Point | 187-189ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 191.7±29.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,4-dichloroanthraquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 455.2±45.0 °C at 760 mmHg |
| Melting Point | 187-189ºC(lit.) |
| Molecular Formula | C14H6Cl2O2 |
| Molecular Weight | 277.102 |
| Flash Point | 191.7±29.3 °C |
| Exact Mass | 275.974487 |
| PSA | 34.14000 |
| LogP | 4.50 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | CAHGWVAXFJXDNI-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c(Cl)ccc(Cl)c21 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,4-dichloroanthracene-9,10-dione |
| 1,4-Dichloro-9,10-anthraquinone |