Sodium L-pyroglutamate structure
|
Common Name | Sodium L-pyroglutamate | ||
|---|---|---|---|---|
| CAS Number | 28874-51-3 | Molecular Weight | 151.096 | |
| Density | 1.45 | Boiling Point | 453.1ºC at 760 mmHg | |
| Molecular Formula | C5H6NNaO3 | Melting Point | 125ºC | |
| MSDS | N/A | Flash Point | 227.8ºC | |
Use of Sodium L-pyroglutamateSodium L-pyroglutamate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | Sodium L-pyroglutamate |
|---|---|
| Synonym | More Synonyms |
| Description | Sodium L-pyroglutamate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| Density | 1.45 |
|---|---|
| Boiling Point | 453.1ºC at 760 mmHg |
| Melting Point | 125ºC |
| Molecular Formula | C5H6NNaO3 |
| Molecular Weight | 151.096 |
| Flash Point | 227.8ºC |
| Exact Mass | 151.024536 |
| PSA | 69.23000 |
| Vapour Pressure | 1.79E-09mmHg at 25°C |
| InChIKey | CRPCXAMJWCDHFM-DFWYDOINSA-M |
| SMILES | O=C1CCC(C(=O)[O-])N1.[Na+] |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2933790090 |
|---|
|
~%
Sodium L-pyrogl... CAS#:28874-51-3 |
| Literature: Ajinomoto Co., Inc. Patent: US2005/239764 A1, 2005 ; Location in patent: Page/Page column 7, 8 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933790090 |
|---|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
| sodium pyrrolidonecarboxylate |
| Sodium L-pyroglutama |
| Sodium (2S)-5-oxo-2-pyrrolidinecarboxylate |
| sodium L-pyrrolidone carboxylate |
| SODIUMPYROGLUTAMICACID |
| Sodium 5-oxo-2-pyrrolidinecarboxylate |
| Proline, 5-oxo-, sodium salt (1:1) |
| L-Proline, 5-oxo-, sodium salt (1:1) |
| sodium (2S)-5-oxopyrrolidine-2-carboxylate |
| L-PCA-NA |
| EINECS 249-277-1 |
| Sodium PCA |
| Sodium pyroglutamate |
| dium L-pyroglutamate |
| L-PCA-Na=SodiumPCA |
| sodium 5-oxo-L-prolinate |
| SodiumL-pyroglutamate |
| UNII:469OTG57A2 |
| Proline, 5-oxo-, monosodium salt |
| sodium salt of pyroglutamic acid |
| 5-Oxoproline sodium salt |