Asn-Pro-Val-PABC-MMAE TFA structure
|
Common Name | Asn-Pro-Val-PABC-MMAE TFA | ||
|---|---|---|---|---|
| CAS Number | 2893871-67-3 | Molecular Weight | 1291.50 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C63H97F3N10O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Asn-Pro-Val-PABC-MMAE TFAAsn-Pro-Val-PABC-MMAE TFA (compound 8) is a potent ADC Linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Asn-Pro-Val-PABC-MMAE TFA |
|---|
| Description | Asn-Pro-Val-PABC-MMAE TFA (compound 8) is a potent ADC Linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C63H97F3N10O15 |
|---|---|
| Molecular Weight | 1291.50 |
| InChIKey | YJEOYBSNSJPQHG-YVTMPSISSA-N |
| SMILES | CCC(C)C(C(CC(=O)N1CCCC1C(OC)C(C)C(=O)NC(C)C(O)c1ccccc1)OC)N(C)C(=O)C(NC(=O)C(C(C)C)N(C)C(=O)OCc1ccc(NC(=O)C(NC(=O)C2CCCN2C(=O)C(N)CC(N)=O)C(C)C)cc1)C(C)C.O=C(O)C(F)(F)F |