Benzeneacetic acid, a-chloro-a-phenyl- structure
|
Common Name | Benzeneacetic acid, a-chloro-a-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 7475-56-1 | Molecular Weight | 246.68900 | |
| Density | 1.283g/cm3 | Boiling Point | 372.7ºC at 760 mmHg | |
| Molecular Formula | C14H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.2ºC | |
| Name | 2-chloro-2,2-diphenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 372.7ºC at 760 mmHg |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 246.68900 |
| Flash Point | 179.2ºC |
| Exact Mass | 246.04500 |
| PSA | 37.30000 |
| LogP | 3.25360 |
| Index of Refraction | 1.604 |
| InChIKey | UJRMHFPTLFNSTA-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Cl)(c1ccccc1)c1ccccc1 |
| HS Code | 2916399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,2-diphenyl-2-chloroacetic acid |
| Chlorodiphenylacetic acid |