(-)-3-DEHYDROSHIKIMIC ACID structure
|
Common Name | (-)-3-DEHYDROSHIKIMIC ACID | ||
|---|---|---|---|---|
| CAS Number | 2922-42-1 | Molecular Weight | 172.13500 | |
| Density | 1.713g/cm3 | Boiling Point | 405.1ºC at 760mmHg | |
| Molecular Formula | C7H8O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213ºC | |
| Name | (-)-3-Dehydro Shikimic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.713g/cm3 |
|---|---|
| Boiling Point | 405.1ºC at 760mmHg |
| Molecular Formula | C7H8O5 |
| Molecular Weight | 172.13500 |
| Flash Point | 213ºC |
| Exact Mass | 172.03700 |
| PSA | 94.83000 |
| Vapour Pressure | 2.99E-08mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | SLWWJZMPHJJOPH-PHDIDXHHSA-N |
| SMILES | O=C(O)C1=CC(=O)C(O)C(O)C1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (4S,5R)-(−)-4,5-Dihydroxy-3-oxo-1-cyclohexene-1-carboxylic acid 5-Dehydroshikimic acid |
| 3-Dehydroshikimic acid |
| (-)-3-DEHYDROSHIKIMIC ACID |