Methanediol,1-(4-nitrophenyl)-, 1,1-diacetate structure
|
Common Name | Methanediol,1-(4-nitrophenyl)-, 1,1-diacetate | ||
|---|---|---|---|---|
| CAS Number | 2929-91-1 | Molecular Weight | 253.20800 | |
| Density | 1.323g/cm3 | Boiling Point | 368.6ºC at 760mmHg | |
| Molecular Formula | C11H11NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.9ºC | |
| Name | [acetyloxy-(4-nitrophenyl)methyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.323g/cm3 |
|---|---|
| Boiling Point | 368.6ºC at 760mmHg |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.20800 |
| Flash Point | 161.9ºC |
| Exact Mass | 253.05900 |
| PSA | 98.42000 |
| LogP | 2.24280 |
| Vapour Pressure | 1.26E-05mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | WGESNIARHZFDHQ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(OC(C)=O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2916399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 220-896-9 |
| 4-nitrophenylmethanediol diacetate |