1,3,5-Triazine-2,4-diamine,6-(3-methylphenyl)- structure
|
Common Name | 1,3,5-Triazine-2,4-diamine,6-(3-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 29366-76-5 | Molecular Weight | 201.22800 | |
| Density | 1.296g/cm3 | Boiling Point | 506.5ºC at 760mmHg | |
| Molecular Formula | C10H11N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.7ºC | |
| Name | 6-(m-tolyl)-1,3,5-triazine-2,4-diamine |
|---|
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 506.5ºC at 760mmHg |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.22800 |
| Flash Point | 292.7ºC |
| Exact Mass | 201.10100 |
| PSA | 90.71000 |
| LogP | 2.17380 |
| Vapour Pressure | 2.2E-10mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | TXXLOPYOLOTHPD-UHFFFAOYSA-N |
| SMILES | Cc1cccc(-c2nc(N)nc(N)n2)c1 |
| HS Code | 2933699090 |
|---|
|
~%
1,3,5-Triazine-... CAS#:29366-76-5 |
| Literature: Ostrogovich; Gheorghiu Gazzetta Chimica Italiana, 1930 , vol. 60, p. 648,650,654,657 Gazzetta Chimica Italiana, 1932 , vol. 62, p. 329 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |