1,3,5-Triazine-2,4-diamine,6-(3-bromophenyl)- structure
|
Common Name | 1,3,5-Triazine-2,4-diamine,6-(3-bromophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 30101-52-1 | Molecular Weight | 266.09700 | |
| Density | 1.715g/cm3 | Boiling Point | 544.8ºC at 760mmHg | |
| Molecular Formula | C9H8BrN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.3ºC | |
| Name | 6-(3-bromophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.715g/cm3 |
|---|---|
| Boiling Point | 544.8ºC at 760mmHg |
| Molecular Formula | C9H8BrN5 |
| Molecular Weight | 266.09700 |
| Flash Point | 283.3ºC |
| Exact Mass | 264.99600 |
| PSA | 90.71000 |
| LogP | 2.62790 |
| Index of Refraction | 1.72 |
| InChIKey | MIOBPAYSHXBHTJ-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)nc(-c2cccc(Br)c2)n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| [182] 2,4-Diamino-6-(3-bromophenyl)-1,3,5-triazine |
| m-Bromophenylguanamin |
| 6-(3-bromo-phenyl)-[1,3,5]triazine-2,4-diamine |