1,3,5-Triazine-2,4-diamine,6-(3-nitrophenyl)- structure
|
Common Name | 1,3,5-Triazine-2,4-diamine,6-(3-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 29366-72-1 | Molecular Weight | 232.19900 | |
| Density | 1.539g/cm3 | Boiling Point | 578.2ºC at 760mmHg | |
| Molecular Formula | C9H8N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.5ºC | |
| Name | 6-(3-nitrophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.539g/cm3 |
|---|---|
| Boiling Point | 578.2ºC at 760mmHg |
| Molecular Formula | C9H8N6O2 |
| Molecular Weight | 232.19900 |
| Flash Point | 303.5ºC |
| Exact Mass | 232.07100 |
| PSA | 136.53000 |
| LogP | 2.29680 |
| Vapour Pressure | 2.3E-13mmHg at 25°C |
| Index of Refraction | 1.729 |
| InChIKey | VPHQFMMMDMEBFG-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)nc(-c2cccc([N+](=O)[O-])c2)n1 |
| HS Code | 2933699090 |
|---|
|
~%
1,3,5-Triazine-... CAS#:29366-72-1 |
| Literature: Am. Cyanamid Co. Patent: US2397396 , 1943 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 6-(3-nitro-phenyl)-[1,3,5]triazine-2,4-diamine |
| 2,4-diamino-6-(3-nitrophenyl)-1,3,5-triazine |
| 2-<3-Nitrophenyl>-4,6-diamino-1.3.5-triazin |
| 6-(3-Nitro-phenyl)-[1,3,5]triazin-2,4-diyldiamin |
| 6-(3-nitro-phenyl)-[1,3,5]triazine-2,4-diyldiamine |
| 1,3,5-Triazine-2,4-diamine,6-(3-nitrophenyl) |
| 2-m-Nitrophenyl-4,6-diamino-s-triazin |
| 2,4-Diamino-6-(m-nitrophenyl)-s-triazin |