6-Nitrobenzothiazole structure
|
Common Name | 6-Nitrobenzothiazole | ||
|---|---|---|---|---|
| CAS Number | 2942-06-5 | Molecular Weight | 180.184 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 333.7±15.0 °C at 760 mmHg | |
| Molecular Formula | C7H4N2O2S | Melting Point | 175-178 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 155.6±20.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 6-nitro-1,3-benzothiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 333.7±15.0 °C at 760 mmHg |
| Melting Point | 175-178 °C(lit.) |
| Molecular Formula | C7H4N2O2S |
| Molecular Weight | 180.184 |
| Flash Point | 155.6±20.4 °C |
| Exact Mass | 179.999344 |
| PSA | 86.95000 |
| LogP | 1.74 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.730 |
| InChIKey | QLUFBCVWKTWKBF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2ncsc2c1 |
| Storage condition | Refrigerator |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Novel amidino substituted 2-phenylbenzothiazoles: synthesis, antitumor evaluation in vitro and acute toxicity testing in vivo.
Bioorg. Med. Chem. 18(3) , 1038-44, (2010) The efficient synthesis of new bis-substituted nitro-amidino, amino-amidino (10a, 10b-13a, 13b) and previously prepared diamidino 2-phenyl-benzothiazoles (9a, 9b) is described. The compounds 11a and 1... |
|
|
Assignment of quaternary carbons in aromatic compounds by long-range heteronuclear shift correlated 2D-NMR spectroscopy and its application to acteoside. Numata A, et al.
Agric. Biol. Chem. 51(4) , 1199-1201, (1987)
|
|
|
Heterocyclic Amplifiers of Phleomycin. IX. Some Derivatives of Fused and Unfused Mono-and Di-aza Heterocycles. Barlin GB and Ireland SJ.
Aust. J. Chem. 38(11) , 1685-1691, (1985)
|
| 6-Nitro-1,3-benzothiazole |
| 6-nitro-benzothiazole |
| EINECS 220-933-9 |
| 6-nitrobenzothiazol |
| MFCD00014569 |
| Benzothiazole, 6-nitro- |
| Benzothiazole,6-nitro |
| 6-nitrobenzothiazole |