6-Nitrobenzo[d]thiazol-2-amine structure
|
Common Name | 6-Nitrobenzo[d]thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 6285-57-0 | Molecular Weight | 195.199 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 411.7±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H5N3O2S | Melting Point | 247-249 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 202.8±26.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Amino-6-nitrobenzothiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 411.7±37.0 °C at 760 mmHg |
| Melting Point | 247-249 °C(lit.) |
| Molecular Formula | C7H5N3O2S |
| Molecular Weight | 195.199 |
| Flash Point | 202.8±26.5 °C |
| Exact Mass | 195.010239 |
| PSA | 112.97000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.798 |
| InChIKey | GPNAVOJCQIEKQF-UHFFFAOYSA-N |
| SMILES | Nc1nc2ccc([N+](=O)[O-])cc2s1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36-S36/37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| RTECS | DL0865000 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 29342080 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2934200090 |
|---|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Synthesis and biological evaluation of benzothiazole derivatives as potent antitumor agents.
Bioorg. Med. Chem. Lett. 15(14) , 3328-32, (2005) Based on 2-methyl-4-nitro-2H-pyrazole-3-carboxylic acid[2-(cyclohexanecarbonylamino)benzothiazol-6-yl]amide (1), which shows selective cytotoxicity against tumorigenic cell lines, 2,6-dichloro-N-[2-(c... |
|
|
Bismuth film electrode at a silver solid amalgam substrate as a new tool for voltammetric determination of electrochemically reducible organic compounds.
Talanta 102 , 68-74, (2012) New type of bismuth film electrode prepared by electrodeposition of bismuth film on a silver solid amalgam substrate (BiF-AgSAE) was tested as a sensor for voltammetric determination of electrochemica... |
|
|
Synthesis and characterization of thermally stable second-order nonlinear optical side-chain polyimides containing thiazole and benzothiazole push-pull chromophores. Tambe SM, et al.
Opt. Mater. 31(6) , 817-25, (2009)
|
| IFLAB-BB F1386-0392 |
| 6-Nitrobenzo[d]thiazol-2-amine |
| 2-amino-6-nitrobenzo-1,3-thiazole |
| 2-BenzothiazolaMine,6-nitro |
| EINECS 228-513-7 |
| 2-Amino-6-nitrobenzothiazole |
| 6-NITRO-2-BENZOTHIAZOLAMINE |
| 2-amino-6-nitrobenzthiazole |
| 6-nitro-1,3-benzothiazol-2-amine |
| 6-nitro-2-benzothiazolamin |
| 6-nitrobenzothiazol-2-amine |
| 2-Amino-6-nitrobenzothiazol |
| 2-amino-6-nitro-1,3-benzothiazole |
| MFCD00005786 |
| 6-nitro-2-amino-benzothiazole |