4',7-Di-O-methylnaringenin structure
|
Common Name | 4',7-Di-O-methylnaringenin | ||
|---|---|---|---|---|
| CAS Number | 29424-96-2 | Molecular Weight | 300.306 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 524.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H16O5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 196.0±23.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 4',7-Di-O-methylnaringenin4',7-Di-O-methylnaringenin is a flavonoid found in Renealmia alpinia[1]. |
| Name | (2S)-5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | 4',7-Di-O-methylnaringenin is a flavonoid found in Renealmia alpinia[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 524.4±50.0 °C at 760 mmHg |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.306 |
| Flash Point | 196.0±23.6 °C |
| Exact Mass | 300.099762 |
| PSA | 64.99000 |
| LogP | 4.02 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | CKEXCBVNKRHAMX-HNNXBMFYSA-N |
| SMILES | COc1ccc(C2CC(=O)c3c(O)cc(OC)cc3O2)cc1 |
| Storage condition | ?20°C |
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| naringenin 4',7-dimethyl ether |
| 5-hydroxy-7,4'-dimethoxyflavone |
| Naringenin 4 inverted exclamation marka,7-dimethyl ether |
| 7,4'-dimethoxy-5-hydroxyflavanone |
| 5-hydroxy-7,4'-dimethoxyflavanone |
| 5-Hydroxy-4',7-dimethoxyflavanone |
| 5-Hydroxy-7-methoxy-2-(4-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Sakuranetin 4 inverted exclamation marka-methyl ether |
| Naringenin 7,4'-dimethyl ether |